C32H36ClN3O8 — CID 135017918
[(1S)-1-(chloromethyl)-5-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dihydrobenzo[e]indol-3-yl]-[5-[2-(dimethylamino)ethoxy]-1H-indol-2-yl]methanone (PubChem CID 135017918) has the molecular formula C32H36ClN3O8 and a molecular weight of 626.11 g/mol. Its IUPAC name is [(1S)-1-(chloromethyl)-5-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dihydrobenzo[e]indol-3-yl]-[5-[2-(dimethylamino)ethoxy]-1H-indol-2-yl]methanone.
| Compound Name | [(1S)-1-(chloromethyl)-5-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dihydrobenzo[e]indol-3-yl]-[5-[2-(dimethylamino)ethoxy]-1H-indol-2-yl]methanone |
|---|---|
| PubChem CID | 135017918 |
| Molecular Formula | C32H36ClN3O8 |
| Molecular Weight | 626.11 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | [(1S)-1-(chloromethyl)-5-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dihydrobenzo[e]indol-3-yl]-[5-[2-(dimethylamino)ethoxy]-1H-indol-2-yl]methanone |
| SMILES | CN(C)CCOc1ccc2[nH]c(C(=O)N3C[C@@H](CCl)c4c3cc(O[C@@H]3OC(CO)[C@H](O)C(O)C3O)c3ccccc43)cc2c1 |
| InChI | InChI=1S/C32H36ClN3O8/c1-35(2)9-10-42-19-7-8-22-17(11-19)12-23(34-22)31(41)36-15-18(14-33)27-21-6-4-3-5-20(21)25(13-24(27)36)43-32-30(40)29(39)28(38)26(16-37)44-32/h3-8,11-13,18,26,28-30,32,34,37-40H,9-10,14-16H2,1-2H3/t18-,26?,28+,29?,30?,32-/m1/s1 |
| InChIKey | LRNFFHQBFKTHCR-XEQMMDGYSA-N |
| XLogP | 2.42 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.11 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|