C17H16O5 — CID 135017986
dimethyl 4-(4-methoxyphenyl)benzene-1,2-dicarboxylate (PubChem CID 135017986) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is dimethyl 4-(4-methoxyphenyl)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-(4-methoxyphenyl)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 135017986 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | dimethyl 4-(4-methoxyphenyl)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(-c2ccc(OC)cc2)cc1C(=O)OC |
| InChI | InChI=1S/C17H16O5/c1-20-13-7-4-11(5-8-13)12-6-9-14(16(18)21-2)15(10-12)17(19)22-3/h4-10H,1-3H3 |
| InChIKey | ZFSCNIHDZRDPQF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |