About 6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one
6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one (PubChem CID 135018051) has the molecular formula C31H27NO2
and a molecular weight of 445.56 g/mol. Its IUPAC name is 6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one.
Molecular Properties
| Compound Name | 6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one |
| PubChem CID | 135018051 |
| Molecular Formula | C31H27NO2 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one |
| SMILES | Cc1ccc(C2=CC3(Oc4ccc(C(C)(C)C)cc42)C(=O)Nc2c3ccc3ccccc23)cc1 |
| InChI | InChI=1S/C31H27NO2/c1-19-9-11-21(12-10-19)25-18-31(34-27-16-14-22(17-24(25)27)30(2,3)4)26-15-13-20-7-5-6-8-23(20)28(26)32-29(31)33/h5-18H,1-4H3,(H,32,33) |
| InChIKey | SBCAIWUKDPCXFQ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one?
The IUPAC name of 6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one (CID 135018051) is 6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one.
What is the SMILES notation for 6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one?
The canonical SMILES for 6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one is Cc1ccc(C2=CC3(Oc4ccc(C(C)(C)C)cc42)C(=O)Nc2c3ccc3ccccc23)cc1.
What is the InChIKey of 6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one?
The InChIKey is SBCAIWUKDPCXFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H27NO2/c1-19-9-11-21(12-10-19)25-18-31(34-27-16-14-22(17-24(25)27)30(2,3)4)26-15-13-20-7-5-6-8-23(20)28(26)32-29(31)33/h5-18H,1-4H3,(H,32,33).
What are the key properties of 6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one?
6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one has a molecular weight of 445.56 g/mol, XLogP of 7.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-tert-butyl-4'-(4-methylphenyl)spiro[1H-benzo[g]indole-3,2'-chromene]-2-one is sourced from PubChem (CID 135018051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).