C24H36O10 — CID 135018100
(3R)-4-[(2R,4S)-4-acetyloxy-6-[[(2S,4Z,6R)-6-ethenyl-4-(2-methoxy-2-oxoethylidene)oxan-2-yl]methyl]-6-hydroxy-5,5-dimethyloxan-2-yl]-3-hydroxybutanoic acid (PubChem CID 135018100) has the molecular formula C24H36O10 and a molecular weight of 484.54 g/mol. Its IUPAC name is (3R)-4-[(2R,4S)-4-acetyloxy-6-[[(2S,4Z,6R)-6-ethenyl-4-(2-methoxy-2-oxoethylidene)oxan-2-yl]methyl]-6-hydroxy-5,5-dimethyloxan-2-yl]-3-hydroxybutanoic acid.
| Compound Name | (3R)-4-[(2R,4S)-4-acetyloxy-6-[[(2S,4Z,6R)-6-ethenyl-4-(2-methoxy-2-oxoethylidene)oxan-2-yl]methyl]-6-hydroxy-5,5-dimethyloxan-2-yl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 135018100 |
| Molecular Formula | C24H36O10 |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | (3R)-4-[(2R,4S)-4-acetyloxy-6-[[(2S,4Z,6R)-6-ethenyl-4-(2-methoxy-2-oxoethylidene)oxan-2-yl]methyl]-6-hydroxy-5,5-dimethyloxan-2-yl]-3-hydroxybutanoic acid |
| SMILES | C=C[C@H]1C/C(=C\C(=O)OC)C[C@@H](CC2(O)O[C@H](C[C@@H](O)CC(=O)O)C[C@H](OC(C)=O)C2(C)C)O1 |
| InChI | InChI=1S/C24H36O10/c1-6-17-7-15(9-22(29)31-5)8-19(33-17)13-24(30)23(3,4)20(32-14(2)25)12-18(34-24)10-16(26)11-21(27)28/h6,9,16-20,26,30H,1,7-8,10-13H2,2-5H3,(H,27,28)/b15-9+/t16-,17+,18-,19+,20+,24?/m1/s1 |
| InChIKey | OPIAQNDRLWHMJV-VCQLRWCHSA-N |
| XLogP | 1.87 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|