About methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate
methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate (PubChem CID 135018127) has the molecular formula C19H29NO2
and a molecular weight of 303.45 g/mol. Its IUPAC name is methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate |
| PubChem CID | 135018127 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate |
| SMILES | CCCN1C=CC(C(=O)OC)=CC1/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C19H29NO2/c1-6-11-20-12-10-17(19(21)22-5)14-18(20)13-16(4)9-7-8-15(2)3/h8,10,12-14,18H,6-7,9,11H2,1-5H3/b16-13+ |
| InChIKey | QCNGWYYOCUGEGR-DTQAZKPQSA-N |
| XLogP | 4.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate?
The IUPAC name of methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate (CID 135018127) is methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate.
What is the SMILES notation for methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate?
The canonical SMILES for methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate is CCCN1C=CC(C(=O)OC)=CC1/C=C(\C)CCC=C(C)C.
What is the InChIKey of methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate?
The InChIKey is QCNGWYYOCUGEGR-DTQAZKPQSA-N. The full InChI is InChI=1S/C19H29NO2/c1-6-11-20-12-10-17(19(21)22-5)14-18(20)13-16(4)9-7-8-15(2)3/h8,10,12-14,18H,6-7,9,11H2,1-5H3/b16-13+.
What are the key properties of methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate?
methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate has a molecular weight of 303.45 g/mol, XLogP of 4.39, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1-propyl-2H-pyridine-4-carboxylate is sourced from PubChem (CID 135018127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).