C18H36F2O5Si — CID 135018190
(Z,5S,6S,7S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorododec-2-ene-1,5,6,7-tetrol (PubChem CID 135018190) has the molecular formula C18H36F2O5Si and a molecular weight of 398.56 g/mol. Its IUPAC name is (Z,5S,6S,7S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorododec-2-ene-1,5,6,7-tetrol.
| Compound Name | (Z,5S,6S,7S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorododec-2-ene-1,5,6,7-tetrol |
|---|---|
| PubChem CID | 135018190 |
| Molecular Formula | C18H36F2O5Si |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (Z,5S,6S,7S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorododec-2-ene-1,5,6,7-tetrol |
| SMILES | CCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H](O)C(F)(F)/C=C\CO |
| InChI | InChI=1S/C18H36F2O5Si/c1-7-8-10-13(25-26(5,6)17(2,3)4)14(22)15(23)16(24)18(19,20)11-9-12-21/h9,11,13-16,21-24H,7-8,10,12H2,1-6H3/b11-9-/t13-,14+,15-,16-/m0/s1 |
| InChIKey | CPNZTIOVSZTMDF-KNZMMQGDSA-N |
| XLogP | 2.83 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|