C40H45NO8 — CID 135018309
methyl 2-acetamido-3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate (PubChem CID 135018309) has the molecular formula C40H45NO8 and a molecular weight of 667.80 g/mol. Its IUPAC name is methyl 2-acetamido-3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate.
| Compound Name | methyl 2-acetamido-3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate |
|---|---|
| PubChem CID | 135018309 |
| Molecular Formula | C40H45NO8 |
| Molecular Weight | 667.80 g/mol |
| Exact Mass | 667.31 |
| IUPAC Name | methyl 2-acetamido-3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate |
| SMILES | COC(=O)C(C[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C40H45NO8/c1-29(42)41-34(40(43)44-2)23-35-37(46-25-31-17-9-4-10-18-31)39(48-27-33-21-13-6-14-22-33)38(47-26-32-19-11-5-12-20-32)36(49-35)28-45-24-30-15-7-3-8-16-30/h3-22,34-39H,23-28H2,1-2H3,(H,41,42)/t34?,35-,36-,37+,38-,39-/m1/s1 |
| InChIKey | JJEQBMNWCYYHAE-IPIFUQGESA-N |
| XLogP | 5.79 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.80 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |