About N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide
N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide (PubChem CID 135018513) has the molecular formula C19H19F2NO2S
and a molecular weight of 363.43 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide |
| PubChem CID | 135018513 |
| Molecular Formula | C19H19F2NO2S |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(CN(C(=O)c2cccs2)C2=CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C19H19F2NO2S/c1-24-16-6-4-14(5-7-16)13-22(18(23)17-3-2-12-25-17)15-8-10-19(20,21)11-9-15/h2-8,12H,9-11,13H2,1H3 |
| InChIKey | BUBAABIHUVMDJU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide?
The IUPAC name of N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide (CID 135018513) is N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide.
What is the SMILES notation for N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide?
The canonical SMILES for N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide is COc1ccc(CN(C(=O)c2cccs2)C2=CCC(F)(F)CC2)cc1.
What is the InChIKey of N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide?
The InChIKey is BUBAABIHUVMDJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F2NO2S/c1-24-16-6-4-14(5-7-16)13-22(18(23)17-3-2-12-25-17)15-8-10-19(20,21)11-9-15/h2-8,12H,9-11,13H2,1H3.
What are the key properties of N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide?
N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide has a molecular weight of 363.43 g/mol, XLogP of 5.10, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluorocyclohexen-1-yl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide is sourced from PubChem (CID 135018513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).