C14H19BrO2 — CID 135018548
5-bromo-6-methoxy-2,2,7,8-tetramethyl-3,4-dihydrochromene (PubChem CID 135018548) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is 5-bromo-6-methoxy-2,2,7,8-tetramethyl-3,4-dihydrochromene.
| Compound Name | 5-bromo-6-methoxy-2,2,7,8-tetramethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 135018548 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 5-bromo-6-methoxy-2,2,7,8-tetramethyl-3,4-dihydrochromene |
| SMILES | COc1c(C)c(C)c2c(c1Br)CCC(C)(C)O2 |
| InChI | InChI=1S/C14H19BrO2/c1-8-9(2)13(16-5)11(15)10-6-7-14(3,4)17-12(8)10/h6-7H2,1-5H3 |
| InChIKey | FSAPKUHQUKDDAX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |