C20H30O7 — CID 135018646
(1R,2R,3R,4S,7R,9S,10S,12R,15S)-2,4,9,12,15-pentahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 135018646) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is (1R,2R,3R,4S,7R,9S,10S,12R,15S)-2,4,9,12,15-pentahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | (1R,2R,3R,4S,7R,9S,10S,12R,15S)-2,4,9,12,15-pentahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 135018646 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (1R,2R,3R,4S,7R,9S,10S,12R,15S)-2,4,9,12,15-pentahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CC1=C2[C@@H](O)C(=O)[C@@]3(C)[C@H]([C@H](O)[C@H](C[C@@H]1O)C2(C)C)[C@]1(O)CO[C@@H]1C[C@@H]3O |
| InChI | InChI=1S/C20H30O7/c1-8-10(21)5-9-14(23)16-19(4,11(22)6-12-20(16,26)7-27-12)17(25)15(24)13(8)18(9,2)3/h9-12,14-16,21-24,26H,5-7H2,1-4H3/t9-,10-,11-,12+,14+,15+,16-,19+,20-/m0/s1 |
| InChIKey | FDHNXBSIWGBGEN-LVAYFOLLSA-N |
| XLogP | -0.47 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|