C18H29NO8 — CID 135018673
ethyl (1S,2R,3S,4R)-3,4-diacetyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate (PubChem CID 135018673) has the molecular formula C18H29NO8 and a molecular weight of 387.43 g/mol. Its IUPAC name is ethyl (1S,2R,3S,4R)-3,4-diacetyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,2R,3S,4R)-3,4-diacetyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 135018673 |
| Molecular Formula | C18H29NO8 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | ethyl (1S,2R,3S,4R)-3,4-diacetyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29NO8/c1-7-24-16(22)12-8-9-13(25-10(2)20)15(26-11(3)21)14(12)19-17(23)27-18(4,5)6/h12-15H,7-9H2,1-6H3,(H,19,23)/t12-,13+,14+,15+/m0/s1 |
| InChIKey | SPJJWKJKFOMSEH-GBJTYRQASA-N |
| XLogP | 1.72 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|