C20H33NO7Si — CID 135018811
benzyl N-[(2S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate (PubChem CID 135018811) has the molecular formula C20H33NO7Si and a molecular weight of 427.57 g/mol. Its IUPAC name is benzyl N-[(2S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate.
| Compound Name | benzyl N-[(2S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 135018811 |
| Molecular Formula | C20H33NO7Si |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | benzyl N-[(2S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1OC(CO)[C@@H](O)C(O)C1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H33NO7Si/c1-20(2,3)29(4,5)28-18-15(17(24)16(23)14(11-22)27-18)21-19(25)26-12-13-9-7-6-8-10-13/h6-10,14-18,22-24H,11-12H2,1-5H3,(H,21,25)/t14?,15?,16-,17?,18+/m1/s1 |
| InChIKey | YJWIXZVOGMRUQY-CHKQFIRCSA-N |
| XLogP | 1.74 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|