C27H37NO7Si — CID 135018812
benzyl N-[(6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate (PubChem CID 135018812) has the molecular formula C27H37NO7Si and a molecular weight of 515.68 g/mol. Its IUPAC name is benzyl N-[(6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate.
| Compound Name | benzyl N-[(6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
|---|---|
| PubChem CID | 135018812 |
| Molecular Formula | C27H37NO7Si |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | benzyl N-[(6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1OC2COC(c3ccccc3)O[C@H]2C(O)C1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H37NO7Si/c1-27(2,3)36(4,5)35-25-21(28-26(30)32-16-18-12-8-6-9-13-18)22(29)23-20(33-25)17-31-24(34-23)19-14-10-7-11-15-19/h6-15,20-25,29H,16-17H2,1-5H3,(H,28,30)/t20?,21?,22?,23-,24?,25+/m1/s1 |
| InChIKey | DQNNICIRUCOAEO-GPSUACIOSA-N |
| XLogP | 4.50 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|