About tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane
tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane (PubChem CID 135018818) has the molecular formula C28H42OSSi
and a molecular weight of 454.80 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane |
| PubChem CID | 135018818 |
| Molecular Formula | C28H42OSSi |
| Molecular Weight | 454.80 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane |
| SMILES | CCCCCC/C=C/[C@H](Sc1ccccc1)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H42OSSi/c1-7-8-9-10-11-18-23-26(30-25-21-16-13-17-22-25)27(24-19-14-12-15-20-24)29-31(5,6)28(2,3)4/h12-23,26-27H,7-11H2,1-6H3/b23-18+/t26-,27-/m0/s1 |
| InChIKey | QLXWNGHVTXSEAF-PXXCSQMASA-N |
| XLogP | 9.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.80 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane?
The IUPAC name of tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane (CID 135018818) is tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane.
What is the SMILES notation for tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane?
The canonical SMILES for tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane is CCCCCC/C=C/[C@H](Sc1ccccc1)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1.
What is the InChIKey of tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane?
The InChIKey is QLXWNGHVTXSEAF-PXXCSQMASA-N. The full InChI is InChI=1S/C28H42OSSi/c1-7-8-9-10-11-18-23-26(30-25-21-16-13-17-22-25)27(24-19-14-12-15-20-24)29-31(5,6)28(2,3)4/h12-23,26-27H,7-11H2,1-6H3/b23-18+/t26-,27-/m0/s1.
What are the key properties of tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane?
tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane has a molecular weight of 454.80 g/mol, XLogP of 9.44, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-[(E,1S,2S)-1-phenyl-2-phenylsulfanyldec-3-enoxy]silane is sourced from PubChem (CID 135018818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).