C20H30O2 — CID 135018829
(1S,3R,7S,8S)-7-hydroxy-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-en-9-one (PubChem CID 135018829) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1S,3R,7S,8S)-7-hydroxy-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-en-9-one.
| Compound Name | (1S,3R,7S,8S)-7-hydroxy-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-en-9-one |
|---|---|
| PubChem CID | 135018829 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1S,3R,7S,8S)-7-hydroxy-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-en-9-one |
| SMILES | C=C1CC[C@H](O)[C@@]2(C)C(=O)CC3=C(C)CC[C@@H](C[C@H]12)C3(C)C |
| InChI | InChI=1S/C20H30O2/c1-12-6-8-14-10-16-13(2)7-9-17(21)20(16,5)18(22)11-15(12)19(14,3)4/h14,16-17,21H,2,6-11H2,1,3-5H3/t14-,16+,17-,20-/m0/s1 |
| InChIKey | PZCBAUYWFALTJK-FORWCCJISA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|