C18H22F3NO5 — CID 135019005
[(2S,4R,5S)-4,6-dimethyl-5-phenylmethoxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl] acetate (PubChem CID 135019005) has the molecular formula C18H22F3NO5 and a molecular weight of 389.37 g/mol. Its IUPAC name is [(2S,4R,5S)-4,6-dimethyl-5-phenylmethoxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl] acetate.
| Compound Name | [(2S,4R,5S)-4,6-dimethyl-5-phenylmethoxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl] acetate |
|---|---|
| PubChem CID | 135019005 |
| Molecular Formula | C18H22F3NO5 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | [(2S,4R,5S)-4,6-dimethyl-5-phenylmethoxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@](C)(NC(=O)C(F)(F)F)[C@H](OCc2ccccc2)C(C)O1 |
| InChI | InChI=1S/C18H22F3NO5/c1-11-15(25-10-13-7-5-4-6-8-13)17(3,22-16(24)18(19,20)21)9-14(26-11)27-12(2)23/h4-8,11,14-15H,9-10H2,1-3H3,(H,22,24)/t11?,14-,15+,17+/m0/s1 |
| InChIKey | IWRMJNRRIZIDTB-NKBVYPNQSA-N |
| XLogP | 2.71 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |