About 6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde
6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 135019040) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is 6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde |
| PubChem CID | 135019040 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | C=CC(C)(C)C1C=C(C=O)C(OC)=CC1=O |
| InChI | InChI=1S/C13H16O3/c1-5-13(2,3)10-6-9(8-14)12(16-4)7-11(10)15/h5-8,10H,1H2,2-4H3 |
| InChIKey | QCOSFEXWOKPQBJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde?
The IUPAC name of 6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde (CID 135019040) is 6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde.
What is the SMILES notation for 6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde?
The canonical SMILES for 6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde is C=CC(C)(C)C1C=C(C=O)C(OC)=CC1=O.
What is the InChIKey of 6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde?
The InChIKey is QCOSFEXWOKPQBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-5-13(2,3)10-6-9(8-14)12(16-4)7-11(10)15/h5-8,10H,1H2,2-4H3.
What are the key properties of 6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde?
6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde has a molecular weight of 220.27 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3-(2-methylbut-3-en-2-yl)-4-oxocyclohexa-1,5-diene-1-carbaldehyde is sourced from PubChem (CID 135019040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).