C15H32O5Si — CID 135019078
(2S,3R,4S)-1-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)hept-6-ene-2,3-diol (PubChem CID 135019078) has the molecular formula C15H32O5Si and a molecular weight of 320.50 g/mol. Its IUPAC name is (2S,3R,4S)-1-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)hept-6-ene-2,3-diol.
| Compound Name | (2S,3R,4S)-1-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)hept-6-ene-2,3-diol |
|---|---|
| PubChem CID | 135019078 |
| Molecular Formula | C15H32O5Si |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (2S,3R,4S)-1-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)hept-6-ene-2,3-diol |
| SMILES | C=CC[C@H](OCOC)[C@H](O)[C@@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O5Si/c1-8-9-13(19-11-18-5)14(17)12(16)10-20-21(6,7)15(2,3)4/h8,12-14,16-17H,1,9-11H2,2-7H3/t12-,13-,14+/m0/s1 |
| InChIKey | ZRPRWGKWLBHKLR-MELADBBJSA-N |
| XLogP | 2.30 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|