C20H25NO7 — CID 135019097
diethyl (10bS)-8,9-dimethoxy-3-oxo-2,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline-1,1-dicarboxylate (PubChem CID 135019097) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is diethyl (10bS)-8,9-dimethoxy-3-oxo-2,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline-1,1-dicarboxylate.
| Compound Name | diethyl (10bS)-8,9-dimethoxy-3-oxo-2,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135019097 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | diethyl (10bS)-8,9-dimethoxy-3-oxo-2,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(=O)N2CCc3cc(OC)c(OC)cc3[C@H]21 |
| InChI | InChI=1S/C20H25NO7/c1-5-27-18(23)20(19(24)28-6-2)11-16(22)21-8-7-12-9-14(25-3)15(26-4)10-13(12)17(20)21/h9-10,17H,5-8,11H2,1-4H3/t17-/m0/s1 |
| InChIKey | ANRCNWMOCJTABK-KRWDZBQOSA-N |
| XLogP | 1.65 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|