C20H30O4 — CID 135019167
(1R,3S,4S,7R,10S)-1,4-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-one (PubChem CID 135019167) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1R,3S,4S,7R,10S)-1,4-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-one.
| Compound Name | (1R,3S,4S,7R,10S)-1,4-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-one |
|---|---|
| PubChem CID | 135019167 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1R,3S,4S,7R,10S)-1,4-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-one |
| SMILES | CC1=C2C(=O)C[C@]3(C)CC[C@H]4OC[C@@]4(O)[C@H]3C[C@](O)(CC1)C2(C)C |
| InChI | InChI=1S/C20H30O4/c1-12-5-8-19(22)10-14-18(4,7-6-15-20(14,23)11-24-15)9-13(21)16(12)17(19,2)3/h14-15,22-23H,5-11H2,1-4H3/t14-,15+,18-,19+,20+/m0/s1 |
| InChIKey | CDOHTVOCFWMJDO-OBNKQFAMSA-N |
| XLogP | 2.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |