About 2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal
2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal (PubChem CID 135019228) has the molecular formula C16H19NO3
and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal.
Molecular Properties
| Compound Name | 2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal |
| PubChem CID | 135019228 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal |
| SMILES | CO[C@@H]1C(=O)N(C(C)(C)C=O)[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H19NO3/c1-16(2,11-18)17-13(14(20-3)15(17)19)10-9-12-7-5-4-6-8-12/h4-11,13-14H,1-3H3/b10-9+/t13-,14+/m1/s1 |
| InChIKey | NLYPOIQAIXELAZ-HOQBHHMFSA-N |
| XLogP | 1.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal?
The IUPAC name of 2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal (CID 135019228) is 2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal.
What is the SMILES notation for 2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal?
The canonical SMILES for 2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal is CO[C@@H]1C(=O)N(C(C)(C)C=O)[C@@H]1/C=C/c1ccccc1.
What is the InChIKey of 2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal?
The InChIKey is NLYPOIQAIXELAZ-HOQBHHMFSA-N. The full InChI is InChI=1S/C16H19NO3/c1-16(2,11-18)17-13(14(20-3)15(17)19)10-9-12-7-5-4-6-8-12/h4-11,13-14H,1-3H3/b10-9+/t13-,14+/m1/s1.
What are the key properties of 2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal?
2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal has a molecular weight of 273.33 g/mol, XLogP of 1.90, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-3-methoxy-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-2-methylpropanal is sourced from PubChem (CID 135019228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).