C21H21NO2 — CID 135019276
2-[(4R)-6,9-dimethyl-3,4-dihydro-1H-pyrano[3,4-b]indol-4-yl]-1-phenylethanone (PubChem CID 135019276) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-[(4R)-6,9-dimethyl-3,4-dihydro-1H-pyrano[3,4-b]indol-4-yl]-1-phenylethanone.
| Compound Name | 2-[(4R)-6,9-dimethyl-3,4-dihydro-1H-pyrano[3,4-b]indol-4-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 135019276 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-[(4R)-6,9-dimethyl-3,4-dihydro-1H-pyrano[3,4-b]indol-4-yl]-1-phenylethanone |
| SMILES | Cc1ccc2c(c1)c1c(n2C)COC[C@@H]1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21NO2/c1-14-8-9-18-17(10-14)21-16(12-24-13-19(21)22(18)2)11-20(23)15-6-4-3-5-7-15/h3-10,16H,11-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | BIJPWJIFMNKKEH-INIZCTEOSA-N |
| XLogP | 4.37 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|