C11H20O3 — CID 135019295
(E,2R,10R)-2,10-dihydroxyundec-6-en-5-one (PubChem CID 135019295) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (E,2R,10R)-2,10-dihydroxyundec-6-en-5-one.
| Compound Name | (E,2R,10R)-2,10-dihydroxyundec-6-en-5-one |
|---|---|
| PubChem CID | 135019295 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (E,2R,10R)-2,10-dihydroxyundec-6-en-5-one |
| SMILES | C[C@@H](O)CC/C=C/C(=O)CC[C@@H](C)O |
| InChI | InChI=1S/C11H20O3/c1-9(12)5-3-4-6-11(14)8-7-10(2)13/h4,6,9-10,12-13H,3,5,7-8H2,1-2H3/b6-4+/t9-,10-/m1/s1 |
| InChIKey | UPPUKTAHZYRIPE-NEPGKVPFSA-N |
| XLogP | 1.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|