C15H26O3 — CID 135019359
(2R,3S,6R,8R,10S)-2-ethyl-3-methyl-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecan-10-ol (PubChem CID 135019359) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (2R,3S,6R,8R,10S)-2-ethyl-3-methyl-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecan-10-ol.
| Compound Name | (2R,3S,6R,8R,10S)-2-ethyl-3-methyl-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecan-10-ol |
|---|---|
| PubChem CID | 135019359 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (2R,3S,6R,8R,10S)-2-ethyl-3-methyl-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecan-10-ol |
| SMILES | C=CC[C@@H]1C[C@H](O)C[C@]2(CC[C@H](C)[C@@H](CC)O2)O1 |
| InChI | InChI=1S/C15H26O3/c1-4-6-13-9-12(16)10-15(17-13)8-7-11(3)14(5-2)18-15/h4,11-14,16H,1,5-10H2,2-3H3/t11-,12-,13+,14+,15+/m0/s1 |
| InChIKey | SGGVAZSVAGQKSR-VQJWOFKYSA-N |
| XLogP | 3.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|