C42H45N4O6+3 — CID 135019372
4-pyridin-4-yl-1-[2-[2-[2-[6-[2-[2-[2-(4-pyridin-4-ylpyridin-1-ium-1-yl)ethoxy]ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]ethyl]pyridin-1-ium (PubChem CID 135019372) has the molecular formula C42H45N4O6+3 and a molecular weight of 701.84 g/mol. Its IUPAC name is 4-pyridin-4-yl-1-[2-[2-[2-[6-[2-[2-[2-(4-pyridin-4-ylpyridin-1-ium-1-yl)ethoxy]ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]ethyl]pyridin-1-ium.
| Compound Name | 4-pyridin-4-yl-1-[2-[2-[2-[6-[2-[2-[2-(4-pyridin-4-ylpyridin-1-ium-1-yl)ethoxy]ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]ethyl]pyridin-1-ium |
|---|---|
| PubChem CID | 135019372 |
| Molecular Formula | C42H45N4O6+3 |
| Molecular Weight | 701.84 g/mol |
| Exact Mass | 701.33 |
| IUPAC Name | 4-pyridin-4-yl-1-[2-[2-[2-[6-[2-[2-[2-(4-pyridin-4-ylpyridin-1-ium-1-yl)ethoxy]ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]ethyl]pyridin-1-ium |
| SMILES | c1cc(-c2cc[n+](CCO[CH+]COCCOc3ccc4cc(OCCOCCOCC[n+]5ccc(-c6ccncc6)cc5)ccc4c3)cc2)ccn1 |
| InChI | InChI=1S/C42H45N4O6/c1-3-41(51-31-29-49-27-25-47-23-21-45-17-9-37(10-18-45)35-5-13-43-14-6-35)34-40-2-4-42(33-39(1)40)52-32-30-50-28-26-48-24-22-46-19-11-38(12-20-46)36-7-15-44-16-8-36/h1-20,25,33-34H,21-24,26-32H2/q+3 |
| InChIKey | DSNZOXCRMFTTLK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.84 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|