C35H50O6Si — CID 135019605
2-[(7aR)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(methoxymethoxy)-6-(methoxymethoxymethyl)-1,4,5,6,7,7a-hexahydroinden-3a-yl]acetaldehyde (PubChem CID 135019605) has the molecular formula C35H50O6Si and a molecular weight of 594.87 g/mol. Its IUPAC name is 2-[(7aR)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(methoxymethoxy)-6-(methoxymethoxymethyl)-1,4,5,6,7,7a-hexahydroinden-3a-yl]acetaldehyde.
| Compound Name | 2-[(7aR)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(methoxymethoxy)-6-(methoxymethoxymethyl)-1,4,5,6,7,7a-hexahydroinden-3a-yl]acetaldehyde |
|---|---|
| PubChem CID | 135019605 |
| Molecular Formula | C35H50O6Si |
| Molecular Weight | 594.87 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | 2-[(7aR)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(methoxymethoxy)-6-(methoxymethoxymethyl)-1,4,5,6,7,7a-hexahydroinden-3a-yl]acetaldehyde |
| SMILES | COCOCC1CC(OCOC)C2(CC=O)C(CCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)=CC[C@@H]2C1 |
| InChI | InChI=1S/C35H50O6Si/c1-34(2,3)42(31-14-8-6-9-15-31,32-16-10-7-11-17-32)41-22-12-13-29-18-19-30-23-28(25-39-26-37-4)24-33(40-27-38-5)35(29,30)20-21-36/h6-11,14-18,21,28,30,33H,12-13,19-20,22-27H2,1-5H3/t28?,30-,33?,35?/m1/s1 |
| InChIKey | DUYFLGNBFFKFKL-WIFWCWKWSA-N |
| XLogP | 5.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.87 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|