C36H56O7Si — CID 135019606
(1S,2S,3aS)-1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-7a-(3-hydroxypropyl)-7-(methoxymethoxy)-5-(methoxymethoxymethyl)-1,2,3,3a,4,5,6,7-octahydroinden-2-ol (PubChem CID 135019606) has the molecular formula C36H56O7Si and a molecular weight of 628.92 g/mol. Its IUPAC name is (1S,2S,3aS)-1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-7a-(3-hydroxypropyl)-7-(methoxymethoxy)-5-(methoxymethoxymethyl)-1,2,3,3a,4,5,6,7-octahydroinden-2-ol.
| Compound Name | (1S,2S,3aS)-1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-7a-(3-hydroxypropyl)-7-(methoxymethoxy)-5-(methoxymethoxymethyl)-1,2,3,3a,4,5,6,7-octahydroinden-2-ol |
|---|---|
| PubChem CID | 135019606 |
| Molecular Formula | C36H56O7Si |
| Molecular Weight | 628.92 g/mol |
| Exact Mass | 628.38 |
| IUPAC Name | (1S,2S,3aS)-1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-7a-(3-hydroxypropyl)-7-(methoxymethoxy)-5-(methoxymethoxymethyl)-1,2,3,3a,4,5,6,7-octahydroinden-2-ol |
| SMILES | COCOCC1CC(OCOC)C2(CCCO)[C@@H](C1)C[C@H](O)[C@H]2CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H56O7Si/c1-35(2,3)44(30-14-8-6-9-15-30,31-16-10-7-11-17-31)43-21-12-18-32-33(38)24-29-22-28(25-41-26-39-4)23-34(42-27-40-5)36(29,32)19-13-20-37/h6-11,14-17,28-29,32-34,37-38H,12-13,18-27H2,1-5H3/t28?,29-,32+,33-,34?,36?/m0/s1 |
| InChIKey | RHRAUJDSZMSITP-CBZNWMSUSA-N |
| XLogP | 5.12 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.92 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|