C39H60O5Si2 — CID 135019610
2-[(7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(methoxymethoxy)-1,4,5,6,7,7a-hexahydroinden-3a-yl]acetaldehyde (PubChem CID 135019610) has the molecular formula C39H60O5Si2 and a molecular weight of 665.08 g/mol. Its IUPAC name is 2-[(7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(methoxymethoxy)-1,4,5,6,7,7a-hexahydroinden-3a-yl]acetaldehyde.
| Compound Name | 2-[(7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(methoxymethoxy)-1,4,5,6,7,7a-hexahydroinden-3a-yl]acetaldehyde |
|---|---|
| PubChem CID | 135019610 |
| Molecular Formula | C39H60O5Si2 |
| Molecular Weight | 665.08 g/mol |
| Exact Mass | 664.40 |
| IUPAC Name | 2-[(7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(methoxymethoxy)-1,4,5,6,7,7a-hexahydroinden-3a-yl]acetaldehyde |
| SMILES | COCOC1CC(CO[Si](C)(C)C(C)(C)C)C[C@H]2CC=C(CCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C12CC=O |
| InChI | InChI=1S/C39H60O5Si2/c1-37(2,3)45(8,9)44-29-31-27-33-23-22-32(39(33,24-25-40)36(28-31)42-30-41-7)17-16-26-43-46(38(4,5)6,34-18-12-10-13-19-34)35-20-14-11-15-21-35/h10-15,18-22,25,31,33,36H,16-17,23-24,26-30H2,1-9H3/t31?,33-,36?,39?/m1/s1 |
| InChIKey | SSUZHWZGIHZQCX-FOWBTAAFSA-N |
| XLogP | 8.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.08 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|