C9H11F4NO2 — CID 135019632
7,7,8,8-tetrafluoro-8a-hydroxy-6-methyl-1,2,5,6-tetrahydroindolizin-3-one (PubChem CID 135019632) has the molecular formula C9H11F4NO2 and a molecular weight of 241.18 g/mol. Its IUPAC name is 7,7,8,8-tetrafluoro-8a-hydroxy-6-methyl-1,2,5,6-tetrahydroindolizin-3-one.
| Compound Name | 7,7,8,8-tetrafluoro-8a-hydroxy-6-methyl-1,2,5,6-tetrahydroindolizin-3-one |
|---|---|
| PubChem CID | 135019632 |
| Molecular Formula | C9H11F4NO2 |
| Molecular Weight | 241.18 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 7,7,8,8-tetrafluoro-8a-hydroxy-6-methyl-1,2,5,6-tetrahydroindolizin-3-one |
| SMILES | CC1CN2C(=O)CCC2(O)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H11F4NO2/c1-5-4-14-6(15)2-3-7(14,16)9(12,13)8(5,10)11/h5,16H,2-4H2,1H3 |
| InChIKey | NKOKMLIKQWNCFB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|