About dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium
dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium (PubChem CID 135019680) has the molecular formula C11H23N2+
and a molecular weight of 183.32 g/mol. Its IUPAC name is dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium.
Molecular Properties
| Compound Name | dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium |
| PubChem CID | 135019680 |
| Molecular Formula | C11H23N2+ |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.19 |
| IUPAC Name | dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium |
| SMILES | C=C(C)N[C@H]1CCCC[C@@H]1[NH+](C)C |
| InChI | InChI=1S/C11H22N2/c1-9(2)12-10-7-5-6-8-11(10)13(3)4/h10-12H,1,5-8H2,2-4H3/p+1/t10-,11-/m0/s1 |
| InChIKey | DYCCMAVNCIZUGA-QWRGUYRKSA-O |
| XLogP | 0.57 |
| TPSA | 16.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium?
The IUPAC name of dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium (CID 135019680) is dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium.
What is the SMILES notation for dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium?
The canonical SMILES for dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium is C=C(C)N[C@H]1CCCC[C@@H]1[NH+](C)C.
What is the InChIKey of dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium?
The InChIKey is DYCCMAVNCIZUGA-QWRGUYRKSA-O. The full InChI is InChI=1S/C11H22N2/c1-9(2)12-10-7-5-6-8-11(10)13(3)4/h10-12H,1,5-8H2,2-4H3/p+1/t10-,11-/m0/s1.
What are the key properties of dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium?
dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium has a molecular weight of 183.32 g/mol, XLogP of 0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[(1S,2S)-2-(prop-1-en-2-ylamino)cyclohexyl]azanium is sourced from PubChem (CID 135019680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).