C11H15F4NO — CID 135019764
(3aS,7aR)-2-methyl-3-(1,1,2,2-tetrafluoroethyl)-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one (PubChem CID 135019764) has the molecular formula C11H15F4NO and a molecular weight of 253.24 g/mol. Its IUPAC name is (3aS,7aR)-2-methyl-3-(1,1,2,2-tetrafluoroethyl)-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one.
| Compound Name | (3aS,7aR)-2-methyl-3-(1,1,2,2-tetrafluoroethyl)-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 135019764 |
| Molecular Formula | C11H15F4NO |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (3aS,7aR)-2-methyl-3-(1,1,2,2-tetrafluoroethyl)-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
| SMILES | CN1C(=O)[C@@H]2CCCC[C@@H]2C1C(F)(F)C(F)F |
| InChI | InChI=1S/C11H15F4NO/c1-16-8(11(14,15)10(12)13)6-4-2-3-5-7(6)9(16)17/h6-8,10H,2-5H2,1H3/t6-,7+,8?/m0/s1 |
| InChIKey | DLEWPEJXGYSKSW-KJFJCRTCSA-N |
| XLogP | 2.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|