C17H18F2N2O — CID 135019931
3-[2-(3,5-difluorophenyl)-4,5-dimethylphenyl]-1,1-dimethylurea (PubChem CID 135019931) has the molecular formula C17H18F2N2O and a molecular weight of 304.34 g/mol. Its IUPAC name is 3-[2-(3,5-difluorophenyl)-4,5-dimethylphenyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(3,5-difluorophenyl)-4,5-dimethylphenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 135019931 |
| Molecular Formula | C17H18F2N2O |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-[2-(3,5-difluorophenyl)-4,5-dimethylphenyl]-1,1-dimethylurea |
| SMILES | Cc1cc(NC(=O)N(C)C)c(-c2cc(F)cc(F)c2)cc1C |
| InChI | InChI=1S/C17H18F2N2O/c1-10-5-15(12-7-13(18)9-14(19)8-12)16(6-11(10)2)20-17(22)21(3)4/h5-9H,1-4H3,(H,20,22) |
| InChIKey | DHGAUDSYDLBNMO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |