About (5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol
(5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol (PubChem CID 135019970) has the molecular formula C20H34OSi
and a molecular weight of 318.58 g/mol. Its IUPAC name is (5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol.
Molecular Properties
| Compound Name | (5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol |
| PubChem CID | 135019970 |
| Molecular Formula | C20H34OSi |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | (5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol |
| SMILES | C=CCC(C)(C)[C@@H](O)C#CC#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H34OSi/c1-10-14-20(8,9)19(21)13-11-12-15-22(16(2)3,17(4)5)18(6)7/h10,16-19,21H,1,14H2,2-9H3/t19-/m0/s1 |
| InChIKey | AEBPMKKEICNMQS-IBGZPJMESA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol?
The IUPAC name of (5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol (CID 135019970) is (5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol.
What is the SMILES notation for (5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol?
The canonical SMILES for (5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol is C=CCC(C)(C)[C@@H](O)C#CC#C[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol?
The InChIKey is AEBPMKKEICNMQS-IBGZPJMESA-N. The full InChI is InChI=1S/C20H34OSi/c1-10-14-20(8,9)19(21)13-11-12-15-22(16(2)3,17(4)5)18(6)7/h10,16-19,21H,1,14H2,2-9H3/t19-/m0/s1.
What are the key properties of (5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol?
(5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol has a molecular weight of 318.58 g/mol, XLogP of 5.17, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-6,6-dimethyl-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol is sourced from PubChem (CID 135019970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).