C20H28O7S — CID 135020012
[(1'R,4'S,4'aR,8'aS)-4',8'a-dihydroxy-4'a-methylspiro[1,3-dioxolane-2,7'-2,3,4,5,6,8-hexahydro-1H-naphthalene]-1'-yl] 4-methylbenzenesulfonate (PubChem CID 135020012) has the molecular formula C20H28O7S and a molecular weight of 412.50 g/mol. Its IUPAC name is [(1'R,4'S,4'aR,8'aS)-4',8'a-dihydroxy-4'a-methylspiro[1,3-dioxolane-2,7'-2,3,4,5,6,8-hexahydro-1H-naphthalene]-1'-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1'R,4'S,4'aR,8'aS)-4',8'a-dihydroxy-4'a-methylspiro[1,3-dioxolane-2,7'-2,3,4,5,6,8-hexahydro-1H-naphthalene]-1'-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135020012 |
| Molecular Formula | C20H28O7S |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [(1'R,4'S,4'aR,8'aS)-4',8'a-dihydroxy-4'a-methylspiro[1,3-dioxolane-2,7'-2,3,4,5,6,8-hexahydro-1H-naphthalene]-1'-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CC[C@H](O)[C@@]3(C)CCC4(C[C@@]23O)OCCO4)cc1 |
| InChI | InChI=1S/C20H28O7S/c1-14-3-5-15(6-4-14)28(23,24)27-17-8-7-16(21)18(2)9-10-19(13-20(17,18)22)25-11-12-26-19/h3-6,16-17,21-22H,7-13H2,1-2H3/t16-,17+,18+,20+/m0/s1 |
| InChIKey | FTYXJPPXDQNEBD-JRBPQWBISA-N |
| XLogP | 1.89 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|