C15H22O3 — CID 135020025
(3'aR,7'aS)-3',3',3'a,7'a-tetramethylspiro[1,3-dioxolane-2,2'-1,4-dihydroindene]-5'-one (PubChem CID 135020025) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3'aR,7'aS)-3',3',3'a,7'a-tetramethylspiro[1,3-dioxolane-2,2'-1,4-dihydroindene]-5'-one.
| Compound Name | (3'aR,7'aS)-3',3',3'a,7'a-tetramethylspiro[1,3-dioxolane-2,2'-1,4-dihydroindene]-5'-one |
|---|---|
| PubChem CID | 135020025 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3'aR,7'aS)-3',3',3'a,7'a-tetramethylspiro[1,3-dioxolane-2,2'-1,4-dihydroindene]-5'-one |
| SMILES | CC1(C)C2(C[C@@]3(C)C=CC(=O)C[C@@]13C)OCCO2 |
| InChI | InChI=1S/C15H22O3/c1-12(2)14(4)9-11(16)5-6-13(14,3)10-15(12)17-7-8-18-15/h5-6H,7-10H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | LEDOLRMPXIFTHG-KGLIPLIRSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |