C18H35ClO3Si — CID 135020152
[(4R,5S,7R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethylnon-1-en-5-yl] carbonochloridate (PubChem CID 135020152) has the molecular formula C18H35ClO3Si and a molecular weight of 363.01 g/mol. Its IUPAC name is [(4R,5S,7R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethylnon-1-en-5-yl] carbonochloridate.
| Compound Name | [(4R,5S,7R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethylnon-1-en-5-yl] carbonochloridate |
|---|---|
| PubChem CID | 135020152 |
| Molecular Formula | C18H35ClO3Si |
| Molecular Weight | 363.01 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | [(4R,5S,7R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethylnon-1-en-5-yl] carbonochloridate |
| SMILES | C=CC[C@@H](C)[C@H](C[C@@H](C)[C@H](C)O[Si](C)(C)C(C)(C)C)OC(=O)Cl |
| InChI | InChI=1S/C18H35ClO3Si/c1-10-11-13(2)16(21-17(19)20)12-14(3)15(4)22-23(8,9)18(5,6)7/h10,13-16H,1,11-12H2,2-9H3/t13-,14-,15+,16+/m1/s1 |
| InChIKey | DRJXVOCVKCOKRL-WCVJEAGWSA-N |
| XLogP | 6.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.01 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|