C15H20N2O3S — CID 135020255
N'-cyclohex-2-en-1-yl-N-(4-methylphenyl)sulfonylacetohydrazide (PubChem CID 135020255) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is N'-cyclohex-2-en-1-yl-N-(4-methylphenyl)sulfonylacetohydrazide.
| Compound Name | N'-cyclohex-2-en-1-yl-N-(4-methylphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 135020255 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N'-cyclohex-2-en-1-yl-N-(4-methylphenyl)sulfonylacetohydrazide |
| SMILES | CC(=O)N(NC1C=CCCC1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H20N2O3S/c1-12-8-10-15(11-9-12)21(19,20)17(13(2)18)16-14-6-4-3-5-7-14/h4,6,8-11,14,16H,3,5,7H2,1-2H3 |
| InChIKey | ZAUXCAKZKSSKFH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|