C29H35NO4 — CID 135020286
1-[(4aS,5S,6R,7S)-7-methyl-6-[(1S)-2-oxo-1,2-diphenylethoxy]-2,3,4,4a,5,6,7,8-octahydroquinolin-5-yl]-4-methoxybutan-2-one (PubChem CID 135020286) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is 1-[(4aS,5S,6R,7S)-7-methyl-6-[(1S)-2-oxo-1,2-diphenylethoxy]-2,3,4,4a,5,6,7,8-octahydroquinolin-5-yl]-4-methoxybutan-2-one.
| Compound Name | 1-[(4aS,5S,6R,7S)-7-methyl-6-[(1S)-2-oxo-1,2-diphenylethoxy]-2,3,4,4a,5,6,7,8-octahydroquinolin-5-yl]-4-methoxybutan-2-one |
|---|---|
| PubChem CID | 135020286 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 1-[(4aS,5S,6R,7S)-7-methyl-6-[(1S)-2-oxo-1,2-diphenylethoxy]-2,3,4,4a,5,6,7,8-octahydroquinolin-5-yl]-4-methoxybutan-2-one |
| SMILES | COCCC(=O)C[C@@H]1[C@H](O[C@H](C(=O)c2ccccc2)c2ccccc2)[C@@H](C)CC2=NCCC[C@H]21 |
| InChI | InChI=1S/C29H35NO4/c1-20-18-26-24(14-9-16-30-26)25(19-23(31)15-17-33-2)28(20)34-29(22-12-7-4-8-13-22)27(32)21-10-5-3-6-11-21/h3-8,10-13,20,24-25,28-29H,9,14-19H2,1-2H3/t20-,24-,25-,28+,29-/m0/s1 |
| InChIKey | YLMKMGXFRLWRFP-GTQLXTCISA-N |
| XLogP | 5.50 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |