C19H27N7O2 — CID 135020297
4-(1-cyclohexyltetrazol-5-yl)-2,2,4-trimethyl-7-nitro-3,5-dihydro-1H-1,5-benzodiazepine (PubChem CID 135020297) has the molecular formula C19H27N7O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-(1-cyclohexyltetrazol-5-yl)-2,2,4-trimethyl-7-nitro-3,5-dihydro-1H-1,5-benzodiazepine.
| Compound Name | 4-(1-cyclohexyltetrazol-5-yl)-2,2,4-trimethyl-7-nitro-3,5-dihydro-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 135020297 |
| Molecular Formula | C19H27N7O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 4-(1-cyclohexyltetrazol-5-yl)-2,2,4-trimethyl-7-nitro-3,5-dihydro-1H-1,5-benzodiazepine |
| SMILES | CC1(C)CC(C)(c2nnnn2C2CCCCC2)Nc2cc([N+](=O)[O-])ccc2N1 |
| InChI | InChI=1S/C19H27N7O2/c1-18(2)12-19(3,17-22-23-24-25(17)13-7-5-4-6-8-13)21-16-11-14(26(27)28)9-10-15(16)20-18/h9-11,13,20-21H,4-8,12H2,1-3H3 |
| InChIKey | MNHHSYALMBLYDB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|