About 7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one
7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one (PubChem CID 135020470) has the molecular formula C15H7BrF3NO
and a molecular weight of 354.13 g/mol. Its IUPAC name is 7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one.
Molecular Properties
| Compound Name | 7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one |
| PubChem CID | 135020470 |
| Molecular Formula | C15H7BrF3NO |
| Molecular Weight | 354.13 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one |
| SMILES | O=c1c(F)cn(-c2ccc(F)cc2F)c2cc(Br)ccc12 |
| InChI | InChI=1S/C15H7BrF3NO/c16-8-1-3-10-14(5-8)20(7-12(19)15(10)21)13-4-2-9(17)6-11(13)18/h1-7H |
| InChIKey | QQDAMUMTMIDTEG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.13 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one?
The IUPAC name of 7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one (CID 135020470) is 7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one.
What is the SMILES notation for 7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one?
The canonical SMILES for 7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one is O=c1c(F)cn(-c2ccc(F)cc2F)c2cc(Br)ccc12.
What is the InChIKey of 7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one?
The InChIKey is QQDAMUMTMIDTEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7BrF3NO/c16-8-1-3-10-14(5-8)20(7-12(19)15(10)21)13-4-2-9(17)6-11(13)18/h1-7H.
What are the key properties of 7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one?
7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one has a molecular weight of 354.13 g/mol, XLogP of 4.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-(2,4-difluorophenyl)-3-fluoroquinolin-4-one is sourced from PubChem (CID 135020470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).