C22H44O6Si2 — CID 135020644
methyl (4R,5R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxo-5-prop-2-enoxyhexanoate (PubChem CID 135020644) has the molecular formula C22H44O6Si2 and a molecular weight of 460.76 g/mol. Its IUPAC name is methyl (4R,5R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxo-5-prop-2-enoxyhexanoate.
| Compound Name | methyl (4R,5R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxo-5-prop-2-enoxyhexanoate |
|---|---|
| PubChem CID | 135020644 |
| Molecular Formula | C22H44O6Si2 |
| Molecular Weight | 460.76 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | methyl (4R,5R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxo-5-prop-2-enoxyhexanoate |
| SMILES | C=CCO[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)CC(=O)OC |
| InChI | InChI=1S/C22H44O6Si2/c1-13-14-26-18(16-27-29(9,10)21(2,3)4)20(17(23)15-19(24)25-8)28-30(11,12)22(5,6)7/h13,18,20H,1,14-16H2,2-12H3/t18-,20+/m1/s1 |
| InChIKey | RUOGBOUUASGCJK-QUCCMNQESA-N |
| XLogP | 5.10 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.76 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|