C20H21NO3 — CID 135020703
ethyl (3R,4S)-2-oxo-4-phenyl-1-(2-phenylethyl)azetidine-3-carboxylate (PubChem CID 135020703) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is ethyl (3R,4S)-2-oxo-4-phenyl-1-(2-phenylethyl)azetidine-3-carboxylate.
| Compound Name | ethyl (3R,4S)-2-oxo-4-phenyl-1-(2-phenylethyl)azetidine-3-carboxylate |
|---|---|
| PubChem CID | 135020703 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | ethyl (3R,4S)-2-oxo-4-phenyl-1-(2-phenylethyl)azetidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)N(CCc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H21NO3/c1-2-24-20(23)17-18(16-11-7-4-8-12-16)21(19(17)22)14-13-15-9-5-3-6-10-15/h3-12,17-18H,2,13-14H2,1H3/t17-,18-/m1/s1 |
| InChIKey | DLTMDQMOALXWSN-QZTJIDSGSA-N |
| XLogP | 2.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|