About (1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one
(1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one (PubChem CID 135020802) has the molecular formula C12H22O2Si
and a molecular weight of 226.39 g/mol. Its IUPAC name is (1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one.
Molecular Properties
| Compound Name | (1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one |
| PubChem CID | 135020802 |
| Molecular Formula | C12H22O2Si |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one |
| SMILES | C=CCC(=O)/C=C/O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H22O2Si/c1-7-8-11(13)9-10-14-15(5,6)12(2,3)4/h7,9-10H,1,8H2,2-6H3/b10-9+ |
| InChIKey | KHHFNDIEWBKWII-MDZDMXLPSA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one?
The IUPAC name of (1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one (CID 135020802) is (1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one.
What is the SMILES notation for (1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one?
The canonical SMILES for (1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one is C=CCC(=O)/C=C/O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one?
The InChIKey is KHHFNDIEWBKWII-MDZDMXLPSA-N. The full InChI is InChI=1S/C12H22O2Si/c1-7-8-11(13)9-10-14-15(5,6)12(2,3)4/h7,9-10H,1,8H2,2-6H3/b10-9+.
What are the key properties of (1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one?
(1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one has a molecular weight of 226.39 g/mol, XLogP of 3.67, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-one is sourced from PubChem (CID 135020802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).