C27H56OSi3 — CID 135020839
triethyl-[(2E,5E)-1-prop-2-enyl-3,6-bis(triethylsilyl)hexa-2,5-dienoxy]silane (PubChem CID 135020839) has the molecular formula C27H56OSi3 and a molecular weight of 481.00 g/mol. Its IUPAC name is triethyl-[(2E,5E)-1-prop-2-enyl-3,6-bis(triethylsilyl)hexa-2,5-dienoxy]silane.
| Compound Name | triethyl-[(2E,5E)-1-prop-2-enyl-3,6-bis(triethylsilyl)hexa-2,5-dienoxy]silane |
|---|---|
| PubChem CID | 135020839 |
| Molecular Formula | C27H56OSi3 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | triethyl-[(2E,5E)-1-prop-2-enyl-3,6-bis(triethylsilyl)hexa-2,5-dienoxy]silane |
| SMILES | C=CCC(/C=C(\C/C=C/[Si](CC)(CC)CC)[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H56OSi3/c1-11-22-26(28-31(18-8,19-9)20-10)25-27(30(15-5,16-6)17-7)23-21-24-29(12-2,13-3)14-4/h11,21,24-26H,1,12-20,22-23H2,2-10H3/b24-21+,27-25+ |
| InChIKey | PMYMXJNIAKNRLC-ZKVFNAHQSA-N |
| XLogP | 9.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|