C32H28O6 — CID 135020990
dimethyl (E)-2,3-bis(2-phenylmethoxyphenyl)but-2-enedioate (PubChem CID 135020990) has the molecular formula C32H28O6 and a molecular weight of 508.57 g/mol. Its IUPAC name is dimethyl (E)-2,3-bis(2-phenylmethoxyphenyl)but-2-enedioate.
| Compound Name | dimethyl (E)-2,3-bis(2-phenylmethoxyphenyl)but-2-enedioate |
|---|---|
| PubChem CID | 135020990 |
| Molecular Formula | C32H28O6 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | dimethyl (E)-2,3-bis(2-phenylmethoxyphenyl)but-2-enedioate |
| SMILES | COC(=O)/C(=C(/C(=O)OC)c1ccccc1OCc1ccccc1)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H28O6/c1-35-31(33)29(25-17-9-11-19-27(25)37-21-23-13-5-3-6-14-23)30(32(34)36-2)26-18-10-12-20-28(26)38-22-24-15-7-4-8-16-24/h3-20H,21-22H2,1-2H3/b30-29+ |
| InChIKey | DKMZUPOFSIPCOX-QVIHXGFCSA-N |
| XLogP | 6.10 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|