C17H24N2O — CID 135021024
(4S,5S)-4-butyl-3-phenyl-5-pyrrolidin-1-yl-4,5-dihydro-1,2-oxazole (PubChem CID 135021024) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (4S,5S)-4-butyl-3-phenyl-5-pyrrolidin-1-yl-4,5-dihydro-1,2-oxazole.
| Compound Name | (4S,5S)-4-butyl-3-phenyl-5-pyrrolidin-1-yl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 135021024 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (4S,5S)-4-butyl-3-phenyl-5-pyrrolidin-1-yl-4,5-dihydro-1,2-oxazole |
| SMILES | CCCC[C@H]1C(c2ccccc2)=NO[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C17H24N2O/c1-2-3-11-15-16(14-9-5-4-6-10-14)18-20-17(15)19-12-7-8-13-19/h4-6,9-10,15,17H,2-3,7-8,11-13H2,1H3/t15-,17-/m0/s1 |
| InChIKey | BSTACVKIGWWSJM-RDJZCZTQSA-N |
| XLogP | 3.65 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |