C18H26N2O — CID 135021025
(4S,5S)-4-pentyl-3-phenyl-5-pyrrolidin-1-yl-4,5-dihydro-1,2-oxazole (PubChem CID 135021025) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is (4S,5S)-4-pentyl-3-phenyl-5-pyrrolidin-1-yl-4,5-dihydro-1,2-oxazole.
| Compound Name | (4S,5S)-4-pentyl-3-phenyl-5-pyrrolidin-1-yl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 135021025 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (4S,5S)-4-pentyl-3-phenyl-5-pyrrolidin-1-yl-4,5-dihydro-1,2-oxazole |
| SMILES | CCCCC[C@H]1C(c2ccccc2)=NO[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C18H26N2O/c1-2-3-5-12-16-17(15-10-6-4-7-11-15)19-21-18(16)20-13-8-9-14-20/h4,6-7,10-11,16,18H,2-3,5,8-9,12-14H2,1H3/t16-,18-/m0/s1 |
| InChIKey | CGXLVBHBJNNHBR-WMZOPIPTSA-N |
| XLogP | 4.04 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|