C20H22N2O — CID 135021027
(4S,5S)-4-benzyl-3-phenyl-5-pyrrolidin-1-yl-4,5-dihydro-1,2-oxazole (PubChem CID 135021027) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is (4S,5S)-4-benzyl-3-phenyl-5-pyrrolidin-1-yl-4,5-dihydro-1,2-oxazole.
| Compound Name | (4S,5S)-4-benzyl-3-phenyl-5-pyrrolidin-1-yl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 135021027 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (4S,5S)-4-benzyl-3-phenyl-5-pyrrolidin-1-yl-4,5-dihydro-1,2-oxazole |
| SMILES | c1ccc(C[C@H]2C(c3ccccc3)=NO[C@@H]2N2CCCC2)cc1 |
| InChI | InChI=1S/C20H22N2O/c1-3-9-16(10-4-1)15-18-19(17-11-5-2-6-12-17)21-23-20(18)22-13-7-8-14-22/h1-6,9-12,18,20H,7-8,13-15H2/t18-,20-/m0/s1 |
| InChIKey | OBJHKVZLSSDMCN-ICSRJNTNSA-N |
| XLogP | 3.70 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |