About triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane
triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane (PubChem CID 135021189) has the molecular formula C23H46OSi2
and a molecular weight of 394.79 g/mol. Its IUPAC name is triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane.
Molecular Properties
| Compound Name | triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane |
| PubChem CID | 135021189 |
| Molecular Formula | C23H46OSi2 |
| Molecular Weight | 394.79 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane |
| SMILES | C=CCC(/C=C(\CC=C(C)C)[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C23H46OSi2/c1-10-17-22(24-26(14-5,15-6)16-7)20-23(19-18-21(8)9)25(11-2,12-3)13-4/h10,18,20,22H,1,11-17,19H2,2-9H3/b23-20+ |
| InChIKey | NIRXJPHOURYXDA-BSYVCWPDSA-N |
| XLogP | 8.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.79 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane?
The IUPAC name of triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane (CID 135021189) is triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane.
What is the SMILES notation for triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane?
The canonical SMILES for triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane is C=CCC(/C=C(\CC=C(C)C)[Si](CC)(CC)CC)O[Si](CC)(CC)CC.
What is the InChIKey of triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane?
The InChIKey is NIRXJPHOURYXDA-BSYVCWPDSA-N. The full InChI is InChI=1S/C23H46OSi2/c1-10-17-22(24-26(14-5,15-6)16-7)20-23(19-18-21(8)9)25(11-2,12-3)13-4/h10,18,20,22H,1,11-17,19H2,2-9H3/b23-20+.
What are the key properties of triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane?
triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane has a molecular weight of 394.79 g/mol, XLogP of 8.28, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(2E)-6-methyl-1-prop-2-enyl-3-triethylsilylhepta-2,5-dienoxy]silane is sourced from PubChem (CID 135021189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).