C35H45NO6 — CID 135021302
2-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-(methoxymethoxy)-8-[2-[4-(methoxymethoxy)phenyl]ethyl]-2-methyl-9H-pyrano[2,3-e]isoindol-7-one (PubChem CID 135021302) has the molecular formula C35H45NO6 and a molecular weight of 575.75 g/mol. Its IUPAC name is 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-(methoxymethoxy)-8-[2-[4-(methoxymethoxy)phenyl]ethyl]-2-methyl-9H-pyrano[2,3-e]isoindol-7-one.
| Compound Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-(methoxymethoxy)-8-[2-[4-(methoxymethoxy)phenyl]ethyl]-2-methyl-9H-pyrano[2,3-e]isoindol-7-one |
|---|---|
| PubChem CID | 135021302 |
| Molecular Formula | C35H45NO6 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-(methoxymethoxy)-8-[2-[4-(methoxymethoxy)phenyl]ethyl]-2-methyl-9H-pyrano[2,3-e]isoindol-7-one |
| SMILES | COCOc1ccc(CCN2Cc3c(cc(OCOC)c4c3OC(C)(CC/C=C(\C)CCC=C(C)C)C=C4)C2=O)cc1 |
| InChI | InChI=1S/C35H45NO6/c1-25(2)9-7-10-26(3)11-8-18-35(4)19-16-29-32(41-24-39-6)21-30-31(33(29)42-35)22-36(34(30)37)20-17-27-12-14-28(15-13-27)40-23-38-5/h9,11-16,19,21H,7-8,10,17-18,20,22-24H2,1-6H3/b26-11+ |
| InChIKey | GJJMBCPUZVSOTB-KBKYJPHKSA-N |
| XLogP | 7.49 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|